C20H18N4O4 — CID 134274677
4-[4-[[2-(cyclopropylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 134274677) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-[4-[[2-(cyclopropylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[2-(cyclopropylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 134274677 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-[4-[[2-(cyclopropylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(Nc3c(NC4CC4)c(=O)c3=O)cc2)ccn1 |
| InChI | InChI=1S/C20H18N4O4/c1-21-20(27)15-10-14(8-9-22-15)28-13-6-4-12(5-7-13)24-17-16(18(25)19(17)26)23-11-2-3-11/h4-11,23-24H,2-3H2,1H3,(H,21,27) |
| InChIKey | LFPGYXWDDILNLU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|