C12H26N2O2 — CID 138743279
2-[(4-tert-butylpiperazin-1-yl)methyl]propane-1,3-diol (PubChem CID 138743279) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(4-tert-butylpiperazin-1-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(4-tert-butylpiperazin-1-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 138743279 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-[(4-tert-butylpiperazin-1-yl)methyl]propane-1,3-diol |
| SMILES | CC(C)(C)N1CCN(CC(CO)CO)CC1 |
| InChI | InChI=1S/C12H26N2O2/c1-12(2,3)14-6-4-13(5-7-14)8-11(9-15)10-16/h11,15-16H,4-10H2,1-3H3 |
| InChIKey | BSJAMDRQUXSZFH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |