C8H19N3O2 — CID 123457361
2-[(4-aminopiperazin-1-yl)methyl]propane-1,3-diol (PubChem CID 123457361) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-[(4-aminopiperazin-1-yl)methyl]propane-1,3-diol.
| Compound Name | 2-[(4-aminopiperazin-1-yl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 123457361 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-[(4-aminopiperazin-1-yl)methyl]propane-1,3-diol |
| SMILES | NN1CCN(CC(CO)CO)CC1 |
| InChI | InChI=1S/C8H19N3O2/c9-11-3-1-10(2-4-11)5-8(6-12)7-13/h8,12-13H,1-7,9H2 |
| InChIKey | RPLLKXXCLGYJHS-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|