C14H30N2O — CID 146548382
(2R)-1-(4-tert-butylpiperazin-1-yl)-3,3-dimethylbutan-2-ol (PubChem CID 146548382) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is (2R)-1-(4-tert-butylpiperazin-1-yl)-3,3-dimethylbutan-2-ol.
| Compound Name | (2R)-1-(4-tert-butylpiperazin-1-yl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 146548382 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | (2R)-1-(4-tert-butylpiperazin-1-yl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)[C@@H](O)CN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H30N2O/c1-13(2,3)12(17)11-15-7-9-16(10-8-15)14(4,5)6/h12,17H,7-11H2,1-6H3/t12-/m0/s1 |
| InChIKey | XEPPFDXJCKOLTQ-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |