C14H30N2O2 — CID 97311891
(2R)-1-[4-(4-hydroxybutyl)piperazin-1-yl]-3,3-dimethylbutan-2-ol (PubChem CID 97311891) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (2R)-1-[4-(4-hydroxybutyl)piperazin-1-yl]-3,3-dimethylbutan-2-ol.
| Compound Name | (2R)-1-[4-(4-hydroxybutyl)piperazin-1-yl]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 97311891 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | (2R)-1-[4-(4-hydroxybutyl)piperazin-1-yl]-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)[C@@H](O)CN1CCN(CCCCO)CC1 |
| InChI | InChI=1S/C14H30N2O2/c1-14(2,3)13(18)12-16-9-7-15(8-10-16)6-4-5-11-17/h13,17-18H,4-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | SHBMENSYKBYIHD-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|