About 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile
4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile (PubChem CID 95309198) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile |
| PubChem CID | 95309198 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile |
| SMILES | CC(C)(C)[C@@H](O)CN1CCN(CCCC#N)CC1 |
| InChI | InChI=1S/C14H27N3O/c1-14(2,3)13(18)12-17-10-8-16(9-11-17)7-5-4-6-15/h13,18H,4-5,7-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | KMDNJPBNTKHKCH-ZDUSSCGKSA-N |
| XLogP | 1.31 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile?
The IUPAC name of 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile (CID 95309198) is 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile.
What is the SMILES notation for 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile?
The canonical SMILES for 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile is CC(C)(C)[C@@H](O)CN1CCN(CCCC#N)CC1.
What is the InChIKey of 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile?
The InChIKey is KMDNJPBNTKHKCH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H27N3O/c1-14(2,3)13(18)12-17-10-8-16(9-11-17)7-5-4-6-15/h13,18H,4-5,7-12H2,1-3H3/t13-/m0/s1.
What are the key properties of 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile?
4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile has a molecular weight of 253.39 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]butanenitrile is sourced from PubChem (CID 95309198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).