C9H14F3N3O — CID 63900880
2-[4-(3,3,3-trifluoro-2-hydroxypropyl)piperazin-1-yl]acetonitrile (PubChem CID 63900880) has the molecular formula C9H14F3N3O and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-[4-(3,3,3-trifluoro-2-hydroxypropyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(3,3,3-trifluoro-2-hydroxypropyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 63900880 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-[4-(3,3,3-trifluoro-2-hydroxypropyl)piperazin-1-yl]acetonitrile |
| SMILES | N#CCN1CCN(CC(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H14F3N3O/c10-9(11,12)8(16)7-15-5-3-14(2-1-13)4-6-15/h8,16H,2-7H2 |
| InChIKey | PFQCXBXIFJXKKT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|