C19H37N3O2 — CID 95332902
1-[4-[(2S)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-5-pyrrolidin-1-ylpentan-1-one (PubChem CID 95332902) has the molecular formula C19H37N3O2 and a molecular weight of 339.52 g/mol. Its IUPAC name is 1-[4-[(2S)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-5-pyrrolidin-1-ylpentan-1-one.
| Compound Name | 1-[4-[(2S)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-5-pyrrolidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 95332902 |
| Molecular Formula | C19H37N3O2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 1-[4-[(2S)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]-5-pyrrolidin-1-ylpentan-1-one |
| SMILES | CC(C)(C)[C@H](O)CN1CCN(C(=O)CCCCN2CCCC2)CC1 |
| InChI | InChI=1S/C19H37N3O2/c1-19(2,3)17(23)16-21-12-14-22(15-13-21)18(24)8-4-5-9-20-10-6-7-11-20/h17,23H,4-16H2,1-3H3/t17-/m1/s1 |
| InChIKey | QNAZBEDFEPKPJI-QGZVFWFLSA-N |
| XLogP | 1.80 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|