C17H30N2O2 — CID 95325711
2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]ethanone (PubChem CID 95325711) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 95325711 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(2R)-2-hydroxy-3,3-dimethylbutyl]piperazin-1-yl]ethanone |
| SMILES | CC(C)(C)[C@@H](O)CN1CCN(C(=O)C[C@@H]2C=CCC2)CC1 |
| InChI | InChI=1S/C17H30N2O2/c1-17(2,3)15(20)13-18-8-10-19(11-9-18)16(21)12-14-6-4-5-7-14/h4,6,14-15,20H,5,7-13H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | GRFZWDKOZJBBIA-CABCVRRESA-N |
| XLogP | 1.89 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|