C18H23ClN4O3 — CID 138746663
3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-(propan-2-ylamino)-2-pyridinyl]-3-iminopropane-1,2-diol (PubChem CID 138746663) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is 3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-(propan-2-ylamino)-2-pyridinyl]-3-iminopropane-1,2-diol.
| Compound Name | 3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-(propan-2-ylamino)-2-pyridinyl]-3-iminopropane-1,2-diol |
|---|---|
| PubChem CID | 138746663 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-(propan-2-ylamino)-2-pyridinyl]-3-iminopropane-1,2-diol |
| SMILES | [H]/N=C(/c1nc(-c2cccnc2OCC)cc(Cl)c1NC(C)C)C(O)CO |
| InChI | InChI=1S/C18H23ClN4O3/c1-4-26-18-11(6-5-7-21-18)13-8-12(19)16(22-10(2)3)17(23-13)15(20)14(25)9-24/h5-8,10,14,20,22,24-25H,4,9H2,1-3H3/b20-15+ |
| InChIKey | TVQFKSHQZMLQCG-HMMYKYKNSA-N |
| XLogP | 2.74 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|