C16H18ClN3O3 — CID 145436220
3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-methyl-2-pyridinyl]-3-iminopropane-1,2-diol (PubChem CID 145436220) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-methyl-2-pyridinyl]-3-iminopropane-1,2-diol.
| Compound Name | 3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-methyl-2-pyridinyl]-3-iminopropane-1,2-diol |
|---|---|
| PubChem CID | 145436220 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-[4-chloro-6-(2-ethoxy-3-pyridinyl)-3-methyl-2-pyridinyl]-3-iminopropane-1,2-diol |
| SMILES | [H]/N=C(/c1nc(-c2cccnc2OCC)cc(Cl)c1C)C(O)CO |
| InChI | InChI=1S/C16H18ClN3O3/c1-3-23-16-10(5-4-6-19-16)12-7-11(17)9(2)15(20-12)14(18)13(22)8-21/h4-7,13,18,21-22H,3,8H2,1-2H3/b18-14+ |
| InChIKey | UIXGLJAFGDKAGW-NBVRZTHBSA-N |
| XLogP | 2.23 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|