C25H27ClFN5O2 — CID 138748635
(1S,2R,5R)-3-[1-(2-amino-3-chloro-5-fluoro-6,7-dihydroquinolin-7-yl)propan-2-yl]-2-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol (PubChem CID 138748635) has the molecular formula C25H27ClFN5O2 and a molecular weight of 483.98 g/mol. Its IUPAC name is (1S,2R,5R)-3-[1-(2-amino-3-chloro-5-fluoro-6,7-dihydroquinolin-7-yl)propan-2-yl]-2-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-3-[1-(2-amino-3-chloro-5-fluoro-6,7-dihydroquinolin-7-yl)propan-2-yl]-2-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 138748635 |
| Molecular Formula | C25H27ClFN5O2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (1S,2R,5R)-3-[1-(2-amino-3-chloro-5-fluoro-6,7-dihydroquinolin-7-yl)propan-2-yl]-2-methyl-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopent-3-ene-1,2-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C=C(C(C)CC2C=c3nc(N)c(Cl)cc3=C(F)C2)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C25H27ClFN5O2/c1-12(6-14-7-19(27)16-9-18(26)23(28)31-20(16)8-14)17-10-21(22(33)25(17,3)34)32-5-4-15-13(2)29-11-30-24(15)32/h4-5,8-12,14,21-22,33-34H,6-7H2,1-3H3,(H2,28,31)/t12?,14?,21-,22+,25-/m1/s1 |
| InChIKey | BYXWFVYGDIUDGS-IVHJTCMSSA-N |
| XLogP | 2.57 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|