C10H11NO2 — CID 138748679
7-methoxy-3,4-dihydroquinolin-4-ol (PubChem CID 138748679) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydroquinolin-4-ol.
| Compound Name | 7-methoxy-3,4-dihydroquinolin-4-ol |
|---|---|
| PubChem CID | 138748679 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 7-methoxy-3,4-dihydroquinolin-4-ol |
| SMILES | COc1ccc2c(c1)N=CCC2O |
| InChI | InChI=1S/C10H11NO2/c1-13-7-2-3-8-9(6-7)11-5-4-10(8)12/h2-3,5-6,10,12H,4H2,1H3 |
| InChIKey | PODFIVFFHGMMEV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |