C18H16ClF4N3O5 — CID 138749162
2-(2-chloroethoxy)ethyl 1-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 138749162) has the molecular formula C18H16ClF4N3O5 and a molecular weight of 465.79 g/mol. Its IUPAC name is 2-(2-chloroethoxy)ethyl 1-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | 2-(2-chloroethoxy)ethyl 1-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 138749162 |
| Molecular Formula | C18H16ClF4N3O5 |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 2-(2-chloroethoxy)ethyl 1-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | O=C(OCCOCCCl)C1CCC(=O)N1c1ccc(-c2noc(C(F)(F)F)n2)c(F)c1 |
| InChI | InChI=1S/C18H16ClF4N3O5/c19-5-6-29-7-8-30-16(28)13-3-4-14(27)26(13)10-1-2-11(12(20)9-10)15-24-17(31-25-15)18(21,22)23/h1-2,9,13H,3-8H2 |
| InChIKey | VQGLKKSBCFCIDG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|