C10H7F4N3OS — CID 161410790
amino-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanethiol (PubChem CID 161410790) has the molecular formula C10H7F4N3OS and a molecular weight of 293.25 g/mol. Its IUPAC name is amino-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanethiol.
| Compound Name | amino-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanethiol |
|---|---|
| PubChem CID | 161410790 |
| Molecular Formula | C10H7F4N3OS |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | amino-[3-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanethiol |
| SMILES | NC(S)c1ccc(-c2noc(C(F)(F)F)n2)c(F)c1 |
| InChI | InChI=1S/C10H7F4N3OS/c11-6-3-4(7(15)19)1-2-5(6)8-16-9(18-17-8)10(12,13)14/h1-3,7,19H,15H2 |
| InChIKey | VVLAVPAPZQCASQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|