C32H22N4S — CID 138749726
3-[6-[6-(4-aminophenyl)phenanthridin-1-yl]-1,3-benzothiazol-2-yl]aniline (PubChem CID 138749726) has the molecular formula C32H22N4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 3-[6-[6-(4-aminophenyl)phenanthridin-1-yl]-1,3-benzothiazol-2-yl]aniline.
| Compound Name | 3-[6-[6-(4-aminophenyl)phenanthridin-1-yl]-1,3-benzothiazol-2-yl]aniline |
|---|---|
| PubChem CID | 138749726 |
| Molecular Formula | C32H22N4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 3-[6-[6-(4-aminophenyl)phenanthridin-1-yl]-1,3-benzothiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc3cccc(-c4ccc5nc(-c6cccc(N)c6)sc5c4)c3c3ccccc23)cc1 |
| InChI | InChI=1S/C32H22N4S/c33-22-14-11-19(12-15-22)31-26-8-2-1-7-25(26)30-24(9-4-10-28(30)35-31)20-13-16-27-29(18-20)37-32(36-27)21-5-3-6-23(34)17-21/h1-18H,33-34H2 |
| InChIKey | NLQFSNLRYAGBLY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|