C35H23N5 — CID 138750075
2,4-diphenyl-6-[4-(1-pyrimidin-4-ylnaphthalen-2-yl)phenyl]-1,3,5-triazine (PubChem CID 138750075) has the molecular formula C35H23N5 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-(1-pyrimidin-4-ylnaphthalen-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-(1-pyrimidin-4-ylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 138750075 |
| Molecular Formula | C35H23N5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 2,4-diphenyl-6-[4-(1-pyrimidin-4-ylnaphthalen-2-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5ccccc5c4-c4ccncn4)cc3)n2)cc1 |
| InChI | InChI=1S/C35H23N5/c1-3-10-26(11-4-1)33-38-34(27-12-5-2-6-13-27)40-35(39-33)28-17-15-25(16-18-28)30-20-19-24-9-7-8-14-29(24)32(30)31-21-22-36-23-37-31/h1-23H |
| InChIKey | KHSPSTCJORSODY-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |