C24H34N2O3 — CID 138751637
3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxy-N-(3-ethylhex-5-en-3-yl)benzamide (PubChem CID 138751637) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxy-N-(3-ethylhex-5-en-3-yl)benzamide.
| Compound Name | 3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxy-N-(3-ethylhex-5-en-3-yl)benzamide |
|---|---|
| PubChem CID | 138751637 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 3-[1-(cyclopropanecarbonyl)piperidin-4-yl]oxy-N-(3-ethylhex-5-en-3-yl)benzamide |
| SMILES | C=CCC(CC)(CC)NC(=O)c1cccc(OC2CCN(C(=O)C3CC3)CC2)c1 |
| InChI | InChI=1S/C24H34N2O3/c1-4-14-24(5-2,6-3)25-22(27)19-8-7-9-21(17-19)29-20-12-15-26(16-13-20)23(28)18-10-11-18/h4,7-9,17-18,20H,1,5-6,10-16H2,2-3H3,(H,25,27) |
| InChIKey | NRJCCIXIGZKBRU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|