C23H21F3N4O5 — CID 138753044
3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(4-oxoimidazolidin-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid (PubChem CID 138753044) has the molecular formula C23H21F3N4O5 and a molecular weight of 490.44 g/mol. Its IUPAC name is 3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(4-oxoimidazolidin-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid.
| Compound Name | 3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(4-oxoimidazolidin-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 138753044 |
| Molecular Formula | C23H21F3N4O5 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1-[4-(4-oxoimidazolidin-1-yl)phenyl]-1,3-diazinane-5-carboxylic acid |
| SMILES | Cc1c(CN2C(=O)C(C(=O)O)CN(c3ccc(N4CNC(=O)C4)cc3)C2=O)cccc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N4O5/c1-13-14(3-2-4-18(13)23(24,25)26)9-30-20(32)17(21(33)34)10-29(22(30)35)16-7-5-15(6-8-16)28-11-19(31)27-12-28/h2-8,17H,9-12H2,1H3,(H,27,31)(H,33,34) |
| InChIKey | LSXWJWKESZAPSE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|