C24H24F4N4O6 — CID 138752954
1-[3-fluoro-4-(2-methoxyethylcarbamoylamino)phenyl]-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-diazinane-5-carboxylic acid (PubChem CID 138752954) has the molecular formula C24H24F4N4O6 and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-[3-fluoro-4-(2-methoxyethylcarbamoylamino)phenyl]-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-diazinane-5-carboxylic acid.
| Compound Name | 1-[3-fluoro-4-(2-methoxyethylcarbamoylamino)phenyl]-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-diazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 138752954 |
| Molecular Formula | C24H24F4N4O6 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-[3-fluoro-4-(2-methoxyethylcarbamoylamino)phenyl]-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-diazinane-5-carboxylic acid |
| SMILES | COCCNC(=O)Nc1ccc(N2CC(C(=O)O)C(=O)N(Cc3cccc(C(F)(F)F)c3C)C2=O)cc1F |
| InChI | InChI=1S/C24H24F4N4O6/c1-13-14(4-3-5-17(13)24(26,27)28)11-32-20(33)16(21(34)35)12-31(23(32)37)15-6-7-19(18(25)10-15)30-22(36)29-8-9-38-2/h3-7,10,16H,8-9,11-12H2,1-2H3,(H,34,35)(H2,29,30,36) |
| InChIKey | FUOGBVPHDLQDEP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|