C12H14N2O3 — CID 25224322
1-(4-methylphenyl)-4-oxo-1,3-diazinane-5-carboxylic acid (PubChem CID 25224322) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-oxo-1,3-diazinane-5-carboxylic acid.
| Compound Name | 1-(4-methylphenyl)-4-oxo-1,3-diazinane-5-carboxylic acid |
|---|---|
| PubChem CID | 25224322 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(4-methylphenyl)-4-oxo-1,3-diazinane-5-carboxylic acid |
| SMILES | Cc1ccc(N2CNC(=O)C(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C12H14N2O3/c1-8-2-4-9(5-3-8)14-6-10(12(16)17)11(15)13-7-14/h2-5,10H,6-7H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | POUURDCVHRULFD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|