C10H13N3S — CID 20632659
5-(4-methylphenyl)-1,3,5-triazinane-2-thione (PubChem CID 20632659) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 5-(4-methylphenyl)-1,3,5-triazinane-2-thione.
| Compound Name | 5-(4-methylphenyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 20632659 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 5-(4-methylphenyl)-1,3,5-triazinane-2-thione |
| SMILES | Cc1ccc(N2CNC(=S)NC2)cc1 |
| InChI | InChI=1S/C10H13N3S/c1-8-2-4-9(5-3-8)13-6-11-10(14)12-7-13/h2-5H,6-7H2,1H3,(H2,11,12,14) |
| InChIKey | NGNBGVPEDDSDEY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|