C15H18N2O4 — CID 82346947
2-methyl-2-[4-(4-methylphenyl)-2,6-dioxopiperazin-1-yl]propanoic acid (PubChem CID 82346947) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-methyl-2-[4-(4-methylphenyl)-2,6-dioxopiperazin-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-(4-methylphenyl)-2,6-dioxopiperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 82346947 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-methyl-2-[4-(4-methylphenyl)-2,6-dioxopiperazin-1-yl]propanoic acid |
| SMILES | Cc1ccc(N2CC(=O)N(C(C)(C)C(=O)O)C(=O)C2)cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-10-4-6-11(7-5-10)16-8-12(18)17(13(19)9-16)15(2,3)14(20)21/h4-7H,8-9H2,1-3H3,(H,20,21) |
| InChIKey | LYHAMVJYTRJJIT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|