C19H25F4NO4 — CID 138756094
tert-butyl N-[1-[2,6-dimethyl-4-(2,2,3,3-tetrafluoropropanoyl)phenoxy]propan-2-yl]carbamate (PubChem CID 138756094) has the molecular formula C19H25F4NO4 and a molecular weight of 407.40 g/mol. Its IUPAC name is tert-butyl N-[1-[2,6-dimethyl-4-(2,2,3,3-tetrafluoropropanoyl)phenoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2,6-dimethyl-4-(2,2,3,3-tetrafluoropropanoyl)phenoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 138756094 |
| Molecular Formula | C19H25F4NO4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | tert-butyl N-[1-[2,6-dimethyl-4-(2,2,3,3-tetrafluoropropanoyl)phenoxy]propan-2-yl]carbamate |
| SMILES | Cc1cc(C(=O)C(F)(F)C(F)F)cc(C)c1OCC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25F4NO4/c1-10-7-13(15(25)19(22,23)16(20)21)8-11(2)14(10)27-9-12(3)24-17(26)28-18(4,5)6/h7-8,12,16H,9H2,1-6H3,(H,24,26) |
| InChIKey | SOFYVDBZHCPFQW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|