C20H16F3NO — CID 138757094
3-(4-methylphenyl)-6-phenyl-2-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 138757094) has the molecular formula C20H16F3NO and a molecular weight of 343.35 g/mol. Its IUPAC name is 3-(4-methylphenyl)-6-phenyl-2-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 3-(4-methylphenyl)-6-phenyl-2-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 138757094 |
| Molecular Formula | C20H16F3NO |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-(4-methylphenyl)-6-phenyl-2-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | Cc1ccc(-c2ccc(-c3ccccc3)nc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO/c1-14-7-9-15(10-8-14)17-11-12-18(16-5-3-2-4-6-16)24-19(17)25-13-20(21,22)23/h2-12H,13H2,1H3 |
| InChIKey | WHGGATRQBRMEEI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |