About 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide
7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 138805635) has the molecular formula C20H16BrNO3S2
and a molecular weight of 462.39 g/mol. Its IUPAC name is 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
Molecular Properties
| Compound Name | 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| PubChem CID | 138805635 |
| Molecular Formula | C20H16BrNO3S2 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cc3c(s2)-c2ccc(Br)cc2S(=O)(=O)C3)cc1 |
| InChI | InChI=1S/C20H16BrNO3S2/c1-12-2-4-13(5-3-12)10-22-20(23)17-8-14-11-27(24,25)18-9-15(21)6-7-16(18)19(14)26-17/h2-9H,10-11H2,1H3,(H,22,23) |
| InChIKey | HSUVTTFULMGARX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The IUPAC name of 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (CID 138805635) is 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
What is the SMILES notation for 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The canonical SMILES for 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide is Cc1ccc(CNC(=O)c2cc3c(s2)-c2ccc(Br)cc2S(=O)(=O)C3)cc1.
What is the InChIKey of 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
The InChIKey is HSUVTTFULMGARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrNO3S2/c1-12-2-4-13(5-3-12)10-22-20(23)17-8-14-11-27(24,25)18-9-15(21)6-7-16(18)19(14)26-17/h2-9H,10-11H2,1H3,(H,22,23).
What are the key properties of 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide?
7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide has a molecular weight of 462.39 g/mol, XLogP of 4.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-N-[(4-methylphenyl)methyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide is sourced from PubChem (CID 138805635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).