C14H25NO4 — CID 138805977
(3aS,5S,6R,7aR)-2-[2-(1,4-dioxan-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 138805977) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is (3aS,5S,6R,7aR)-2-[2-(1,4-dioxan-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aS,5S,6R,7aR)-2-[2-(1,4-dioxan-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 138805977 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (3aS,5S,6R,7aR)-2-[2-(1,4-dioxan-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | O[C@@H]1C[C@H]2CN(CCC3COCCO3)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C14H25NO4/c16-13-5-10-7-15(8-11(10)6-14(13)17)2-1-12-9-18-3-4-19-12/h10-14,16-17H,1-9H2/t10-,11+,12?,13+,14- |
| InChIKey | NOUZXLDAZBSTOD-IYHQDGGJSA-N |
| XLogP | -0.14 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |