C12H21NO2 — CID 130804462
2-[2-(oxiran-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130804462) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[2-(oxiran-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-[2-(oxiran-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130804462 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[2-(oxiran-2-yl)ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | OC1CCC2CN(CCC3CO3)CC2C1 |
| InChI | InChI=1S/C12H21NO2/c14-11-2-1-9-6-13(7-10(9)5-11)4-3-12-8-15-12/h9-12,14H,1-8H2 |
| InChIKey | QASCOWGVDNRWPD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|