C11H21NO — CID 142312907
5-ethoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 142312907) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 5-ethoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | 5-ethoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 142312907 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 5-ethoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CCOC1CCC2CN(C)CC2C1 |
| InChI | InChI=1S/C11H21NO/c1-3-13-11-5-4-9-7-12(2)8-10(9)6-11/h9-11H,3-8H2,1-2H3 |
| InChIKey | OSOWIYWWBVPBDT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |