C12H25NO — CID 142312716
ethane;5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 142312716) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | ethane;5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 142312716 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | ethane;5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CC.COC1CCC2CN(C)CC2C1 |
| InChI | InChI=1S/C10H19NO.C2H6/c1-11-6-8-3-4-10(12-2)5-9(8)7-11;1-2/h8-10H,3-7H2,1-2H3;1-2H3 |
| InChIKey | KUJFEGUGOTUNCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |