C29H38N4O6 — CID 138807714
(8S,15S)-15-benzyl-8-[(2S)-butan-2-yl]-21-methoxy-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone (PubChem CID 138807714) has the molecular formula C29H38N4O6 and a molecular weight of 538.65 g/mol. Its IUPAC name is (8S,15S)-15-benzyl-8-[(2S)-butan-2-yl]-21-methoxy-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone.
| Compound Name | (8S,15S)-15-benzyl-8-[(2S)-butan-2-yl]-21-methoxy-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone |
|---|---|
| PubChem CID | 138807714 |
| Molecular Formula | C29H38N4O6 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (8S,15S)-15-benzyl-8-[(2S)-butan-2-yl]-21-methoxy-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)CCNC(=O)[C@H](Cc2ccccc2)NC(=O)c2ccc(OC)c(c2)OCCCNC1=O |
| InChI | InChI=1S/C29H38N4O6/c1-4-19(2)26-29(37)30-14-8-16-39-24-18-21(11-12-23(24)38-3)27(35)32-22(17-20-9-6-5-7-10-20)28(36)31-15-13-25(34)33-26/h5-7,9-12,18-19,22,26H,4,8,13-17H2,1-3H3,(H,30,37)(H,31,36)(H,32,35)(H,33,34)/t19-,22-,26-/m0/s1 |
| InChIKey | IVYBZRBYRGOEHE-NHZRIVAWSA-N |
| XLogP | 1.97 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |