C27H34N4O6 — CID 137341610
(8S,15S)-15-benzyl-21-methoxy-8,9-dimethyl-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone (PubChem CID 137341610) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is (8S,15S)-15-benzyl-21-methoxy-8,9-dimethyl-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone.
| Compound Name | (8S,15S)-15-benzyl-21-methoxy-8,9-dimethyl-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone |
|---|---|
| PubChem CID | 137341610 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (8S,15S)-15-benzyl-21-methoxy-8,9-dimethyl-2-oxa-6,9,13,16-tetrazabicyclo[16.3.1]docosa-1(21),18(22),19-triene-7,10,14,17-tetrone |
| SMILES | COc1ccc2cc1OCCCNC(=O)[C@H](C)N(C)C(=O)CCNC(=O)[C@H](Cc1ccccc1)NC2=O |
| InChI | InChI=1S/C27H34N4O6/c1-18-25(33)28-13-7-15-37-23-17-20(10-11-22(23)36-3)26(34)30-21(16-19-8-5-4-6-9-19)27(35)29-14-12-24(32)31(18)2/h4-6,8-11,17-18,21H,7,12-16H2,1-3H3,(H,28,33)(H,29,35)(H,30,34)/t18-,21-/m0/s1 |
| InChIKey | DDSLYHKVOBONOY-RXVVDRJESA-N |
| XLogP | 1.29 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |