C30H40N4O4 — CID 67950326
(16R,19R)-16-benzyl-19,20-dimethyl-4-oxa-1,14,17,20-tetrazatricyclo[20.4.0.05,10]hexacosa-5,7,9-triene-15,18,21-trione (PubChem CID 67950326) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is (16R,19R)-16-benzyl-19,20-dimethyl-4-oxa-1,14,17,20-tetrazatricyclo[20.4.0.05,10]hexacosa-5,7,9-triene-15,18,21-trione.
| Compound Name | (16R,19R)-16-benzyl-19,20-dimethyl-4-oxa-1,14,17,20-tetrazatricyclo[20.4.0.05,10]hexacosa-5,7,9-triene-15,18,21-trione |
|---|---|
| PubChem CID | 67950326 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (16R,19R)-16-benzyl-19,20-dimethyl-4-oxa-1,14,17,20-tetrazatricyclo[20.4.0.05,10]hexacosa-5,7,9-triene-15,18,21-trione |
| SMILES | C[C@@H]1C(=O)N[C@H](Cc2ccccc2)C(=O)NCCCc2ccccc2OCCN2CCCCC2C(=O)N1C |
| InChI | InChI=1S/C30H40N4O4/c1-22-28(35)32-25(21-23-11-4-3-5-12-23)29(36)31-17-10-14-24-13-6-7-16-27(24)38-20-19-34-18-9-8-15-26(34)30(37)33(22)2/h3-7,11-13,16,22,25-26H,8-10,14-15,17-21H2,1-2H3,(H,31,36)(H,32,35)/t22-,25-,26?/m1/s1 |
| InChIKey | UUAYKJJJWSQNCV-NQXVELOOSA-N |
| XLogP | 2.56 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |