C26H32Cl2N4O4 — CID 67950364
(9R,12R)-21-chloro-12-[(4-chlorophenyl)methyl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 67950364) has the molecular formula C26H32Cl2N4O4 and a molecular weight of 535.47 g/mol. Its IUPAC name is (9R,12R)-21-chloro-12-[(4-chlorophenyl)methyl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (9R,12R)-21-chloro-12-[(4-chlorophenyl)methyl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 67950364 |
| Molecular Formula | C26H32Cl2N4O4 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | (9R,12R)-21-chloro-12-[(4-chlorophenyl)methyl]-8,9-dimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | C[C@@H]1C(=O)N[C@H](Cc2ccc(Cl)cc2)C(=O)NCCCc2ccc(Cl)cc2OCCNCC(=O)N1C |
| InChI | InChI=1S/C26H32Cl2N4O4/c1-17-25(34)31-22(14-18-5-8-20(27)9-6-18)26(35)30-11-3-4-19-7-10-21(28)15-23(19)36-13-12-29-16-24(33)32(17)2/h5-10,15,17,22,29H,3-4,11-14,16H2,1-2H3,(H,30,35)(H,31,34)/t17-,22-/m1/s1 |
| InChIKey | AUBRRKBFDNNZQA-VGOFRKELSA-N |
| XLogP | 2.60 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |