C34H42N6O7 — CID 154822233
(14R,17S)-14-benzyl-22,23-dimethoxy-17-methyl-9-(pyridin-3-ylmethyl)-2-oxa-6,9,12,15,18-pentazabicyclo[18.2.2]tetracosa-1(22),20,23-triene-7,13,16,19-tetrone (PubChem CID 154822233) has the molecular formula C34H42N6O7 and a molecular weight of 646.75 g/mol. Its IUPAC name is (14R,17S)-14-benzyl-22,23-dimethoxy-17-methyl-9-(pyridin-3-ylmethyl)-2-oxa-6,9,12,15,18-pentazabicyclo[18.2.2]tetracosa-1(22),20,23-triene-7,13,16,19-tetrone.
| Compound Name | (14R,17S)-14-benzyl-22,23-dimethoxy-17-methyl-9-(pyridin-3-ylmethyl)-2-oxa-6,9,12,15,18-pentazabicyclo[18.2.2]tetracosa-1(22),20,23-triene-7,13,16,19-tetrone |
|---|---|
| PubChem CID | 154822233 |
| Molecular Formula | C34H42N6O7 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (14R,17S)-14-benzyl-22,23-dimethoxy-17-methyl-9-(pyridin-3-ylmethyl)-2-oxa-6,9,12,15,18-pentazabicyclo[18.2.2]tetracosa-1(22),20,23-triene-7,13,16,19-tetrone |
| SMILES | COc1cc2cc(OC)c1OCCCNC(=O)CN(Cc1cccnc1)CCNC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@H](C)NC2=O |
| InChI | InChI=1S/C34H42N6O7/c1-23-32(42)39-27(17-24-9-5-4-6-10-24)34(44)37-14-15-40(21-25-11-7-12-35-20-25)22-30(41)36-13-8-16-47-31-28(45-2)18-26(33(43)38-23)19-29(31)46-3/h4-7,9-12,18-20,23,27H,8,13-17,21-22H2,1-3H3,(H,36,41)(H,37,44)(H,38,43)(H,39,42)/t23-,27+/m0/s1 |
| InChIKey | CTTCJMMNGFKCCC-WNCULLNHSA-N |
| XLogP | 1.46 |
| TPSA | 160.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|