C31H36N4O5 — CID 155492863
3,4-dimethoxy-13-(pyridin-3-ylmethyl)-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione (PubChem CID 155492863) has the molecular formula C31H36N4O5 and a molecular weight of 544.65 g/mol. Its IUPAC name is 3,4-dimethoxy-13-(pyridin-3-ylmethyl)-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione.
| Compound Name | 3,4-dimethoxy-13-(pyridin-3-ylmethyl)-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione |
|---|---|
| PubChem CID | 155492863 |
| Molecular Formula | C31H36N4O5 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 3,4-dimethoxy-13-(pyridin-3-ylmethyl)-21-oxa-10,13,17-triazatetracyclo[16.6.2.12,6.022,26]heptacosa-1(25),2,4,6(27),22(26),23-hexaene-9,16-dione |
| SMILES | COc1cc2cc(c1OC)-c1ccc3c(c1)C(CCO3)NC(=O)CCN(Cc1cccnc1)CCNC(=O)CC2 |
| InChI | InChI=1S/C31H36N4O5/c1-38-28-17-21-5-8-29(36)33-12-14-35(20-22-4-3-11-32-19-22)13-9-30(37)34-26-10-15-40-27-7-6-23(18-25(26)27)24(16-21)31(28)39-2/h3-4,6-7,11,16-19,26H,5,8-10,12-15,20H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | OOMJWNBMHJITRW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |