C10H13N9O — CID 138810990
3,5-diamino-N-(diaminomethylidene)-6-(1-methylpyrazol-4-yl)pyrazine-2-carboxamide (PubChem CID 138810990) has the molecular formula C10H13N9O and a molecular weight of 275.28 g/mol. Its IUPAC name is 3,5-diamino-N-(diaminomethylidene)-6-(1-methylpyrazol-4-yl)pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-N-(diaminomethylidene)-6-(1-methylpyrazol-4-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 138810990 |
| Molecular Formula | C10H13N9O |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3,5-diamino-N-(diaminomethylidene)-6-(1-methylpyrazol-4-yl)pyrazine-2-carboxamide |
| SMILES | Cn1cc(-c2nc(C(=O)N=C(N)N)c(N)nc2N)cn1 |
| InChI | InChI=1S/C10H13N9O/c1-19-3-4(2-15-19)5-7(11)17-8(12)6(16-5)9(20)18-10(13)14/h2-3H,1H3,(H4,11,12,17)(H4,13,14,18,20) |
| InChIKey | MHKIPNGQRFWGIB-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 177.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|