C24H23N5OS2 — CID 1388445
2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-thiophen-2-ylethylideneamino)acetamide (PubChem CID 1388445) has the molecular formula C24H23N5OS2 and a molecular weight of 461.62 g/mol. Its IUPAC name is 2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-thiophen-2-ylethylideneamino)acetamide.
| Compound Name | 2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-thiophen-2-ylethylideneamino)acetamide |
|---|---|
| PubChem CID | 1388445 |
| Molecular Formula | C24H23N5OS2 |
| Molecular Weight | 461.62 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1-thiophen-2-ylethylideneamino)acetamide |
| SMILES | CC(=NNC(=O)CSc1nnc(-c2ccc(C)cc2)n1-c1ccc(C)cc1)c1cccs1 |
| InChI | InChI=1S/C24H23N5OS2/c1-16-6-10-19(11-7-16)23-27-28-24(29(23)20-12-8-17(2)9-13-20)32-15-22(30)26-25-18(3)21-5-4-14-31-21/h4-14H,15H2,1-3H3,(H,26,30) |
| InChIKey | LHVDZFGAXBDUQL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|