C10H11I3N2OS — CID 138858054
1-methyl-2,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-9-ium-1-ol triiodide (PubChem CID 138858054) has the molecular formula C10H11I3N2OS and a molecular weight of 587.99 g/mol. Its IUPAC name is 1-methyl-2,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-9-ium-1-ol triiodide.
| Compound Name | 1-methyl-2,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-9-ium-1-ol triiodide |
|---|---|
| PubChem CID | 138858054 |
| Molecular Formula | C10H11I3N2OS |
| Molecular Weight | 587.99 g/mol |
| Exact Mass | 587.77 |
| IUPAC Name | 1-methyl-2,4-dihydro-[1,3]thiazolo[3,2-a]benzimidazol-9-ium-1-ol triiodide |
| SMILES | CC1(O)CSc2[nH]c3ccccc3[n+]21.I[I-]I |
| InChI | InChI=1S/C10H10N2OS.I3/c1-10(13)6-14-9-11-7-4-2-3-5-8(7)12(9)10;1-3-2/h2-5,13H,6H2,1H3;/q;-1/p+1 |
| InChIKey | SRARUKDMIRJGQR-UHFFFAOYSA-O |
| XLogP | 0.00 |
| TPSA | 39.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.99 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|