About 1H-benzimidazol-3-ium triiodide
1H-benzimidazol-3-ium triiodide (PubChem CID 138857998) has the molecular formula C7H7I3N2
and a molecular weight of 499.86 g/mol. Its IUPAC name is 1H-benzimidazol-3-ium triiodide.
Molecular Properties
| Compound Name | 1H-benzimidazol-3-ium triiodide |
| PubChem CID | 138857998 |
| Molecular Formula | C7H7I3N2 |
| Molecular Weight | 499.86 g/mol |
| Exact Mass | 499.77 |
| IUPAC Name | 1H-benzimidazol-3-ium triiodide |
| SMILES | I[I-]I.c1ccc2[nH+]c[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.I3/c1-2-4-7-6(3-1)8-5-9-7;1-3-2/h1-5H,(H,8,9);/q;-1/p+1 |
| InChIKey | BZFVPLGAPPSTJC-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 29.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.86 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-3-ium triiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-3-ium triiodide?
The IUPAC name of 1H-benzimidazol-3-ium triiodide (CID 138857998) is 1H-benzimidazol-3-ium triiodide.
What is the SMILES notation for 1H-benzimidazol-3-ium triiodide?
The canonical SMILES for 1H-benzimidazol-3-ium triiodide is I[I-]I.c1ccc2[nH+]c[nH]c2c1.
What is the InChIKey of 1H-benzimidazol-3-ium triiodide?
The InChIKey is BZFVPLGAPPSTJC-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6N2.I3/c1-2-4-7-6(3-1)8-5-9-7;1-3-2/h1-5H,(H,8,9);/q;-1/p+1.
What are the key properties of 1H-benzimidazol-3-ium triiodide?
1H-benzimidazol-3-ium triiodide has a molecular weight of 499.86 g/mol, XLogP of -0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-3-ium triiodide is sourced from PubChem (CID 138857998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).