C11H11BrNS2+ — CID 912179
(1R)-1-(bromomethyl)-1-methyl-2H-[1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium (PubChem CID 912179) has the molecular formula C11H11BrNS2+ and a molecular weight of 301.25 g/mol. Its IUPAC name is (1R)-1-(bromomethyl)-1-methyl-2H-[1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium.
| Compound Name | (1R)-1-(bromomethyl)-1-methyl-2H-[1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium |
|---|---|
| PubChem CID | 912179 |
| Molecular Formula | C11H11BrNS2+ |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | (1R)-1-(bromomethyl)-1-methyl-2H-[1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium |
| SMILES | C[C@]1(CBr)CSc2sc3ccccc3[n+]21 |
| InChI | InChI=1S/C11H11BrNS2/c1-11(6-12)7-14-10-13(11)8-4-2-3-5-9(8)15-10/h2-5H,6-7H2,1H3/q+1/t11-/m0/s1 |
| InChIKey | WACWFMMZDKTJNV-NSHDSACASA-N |
| XLogP | 3.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|