C10H10Br3NS2 — CID 51056960
3-bromo-3,4-dihydro-2H-[1,3]thiazino[2,3-b][1,3]benzothiazol-5-ium;bromide;hydrobromide (PubChem CID 51056960) has the molecular formula C10H10Br3NS2 and a molecular weight of 448.04 g/mol. Its IUPAC name is 3-bromo-3,4-dihydro-2H-[1,3]thiazino[2,3-b][1,3]benzothiazol-5-ium;bromide;hydrobromide.
| Compound Name | 3-bromo-3,4-dihydro-2H-[1,3]thiazino[2,3-b][1,3]benzothiazol-5-ium;bromide;hydrobromide |
|---|---|
| PubChem CID | 51056960 |
| Molecular Formula | C10H10Br3NS2 |
| Molecular Weight | 448.04 g/mol |
| Exact Mass | 444.78 |
| IUPAC Name | 3-bromo-3,4-dihydro-2H-[1,3]thiazino[2,3-b][1,3]benzothiazol-5-ium;bromide;hydrobromide |
| SMILES | Br.BrC1CSc2sc3ccccc3[n+]2C1.[Br-] |
| InChI | InChI=1S/C10H9BrNS2.2BrH/c11-7-5-12-8-3-1-2-4-9(8)14-10(12)13-6-7;;/h1-4,7H,5-6H2;2*1H/q+1;;/p-1 |
| InChIKey | MRGVDGJIIRARHO-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.04 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|