C12H8NS2+ — CID 59824643
8,11-dithia-1-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene (PubChem CID 59824643) has the molecular formula C12H8NS2+ and a molecular weight of 230.34 g/mol. Its IUPAC name is 8,11-dithia-1-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene.
| Compound Name | 8,11-dithia-1-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
|---|---|
| PubChem CID | 59824643 |
| Molecular Formula | C12H8NS2+ |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 8,11-dithia-1-azoniatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
| SMILES | c1ccc2c(c1)sc1[n+]2Cc2ccsc2-1 |
| InChI | InChI=1S/C12H8NS2/c1-2-4-10-9(3-1)13-7-8-5-6-14-11(8)12(13)15-10/h1-6H,7H2/q+1 |
| InChIKey | KVYCHZWSRKVFDD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|