C11H13N2OS+ — CID 844003
(3R)-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-5-ium-3-ol (PubChem CID 844003) has the molecular formula C11H13N2OS+ and a molecular weight of 221.31 g/mol. Its IUPAC name is (3R)-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-5-ium-3-ol.
| Compound Name | (3R)-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-5-ium-3-ol |
|---|---|
| PubChem CID | 844003 |
| Molecular Formula | C11H13N2OS+ |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (3R)-1-methyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazol-5-ium-3-ol |
| SMILES | CN1C[C@@H](O)C[n+]2c1sc1ccccc12 |
| InChI | InChI=1S/C11H13N2OS/c1-12-6-8(14)7-13-9-4-2-3-5-10(9)15-11(12)13/h2-5,8,14H,6-7H2,1H3/q+1/t8-/m1/s1 |
| InChIKey | HHHJPHULBIHKDD-MRVPVSSYSA-N |
| XLogP | 1.00 |
| TPSA | 27.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|