C16H23N4S+ — CID 154150742
2-piperazin-1-yl-3-piperidin-1-yl-1,3-benzothiazol-3-ium (PubChem CID 154150742) has the molecular formula C16H23N4S+ and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-piperazin-1-yl-3-piperidin-1-yl-1,3-benzothiazol-3-ium.
| Compound Name | 2-piperazin-1-yl-3-piperidin-1-yl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 154150742 |
| Molecular Formula | C16H23N4S+ |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-piperazin-1-yl-3-piperidin-1-yl-1,3-benzothiazol-3-ium |
| SMILES | c1ccc2c(c1)sc(N1CCNCC1)[n+]2N1CCCCC1 |
| InChI | InChI=1S/C16H23N4S/c1-4-10-19(11-5-1)20-14-6-2-3-7-15(14)21-16(20)18-12-8-17-9-13-18/h2-3,6-7,17H,1,4-5,8-13H2/q+1 |
| InChIKey | DIEFIYXWJSDNRO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 22.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|