C18H20N2O2 — CID 138858134
[(3,3-dimethyl-1-pyridin-3-ylbutan-2-ylidene)amino] benzoate (PubChem CID 138858134) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is [(3,3-dimethyl-1-pyridin-3-ylbutan-2-ylidene)amino] benzoate.
| Compound Name | [(3,3-dimethyl-1-pyridin-3-ylbutan-2-ylidene)amino] benzoate |
|---|---|
| PubChem CID | 138858134 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(3,3-dimethyl-1-pyridin-3-ylbutan-2-ylidene)amino] benzoate |
| SMILES | CC(C)(C)C(Cc1cccnc1)=NOC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-18(2,3)16(12-14-8-7-11-19-13-14)20-22-17(21)15-9-5-4-6-10-15/h4-11,13H,12H2,1-3H3 |
| InChIKey | DMTNFQWNFPOZLJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|