C16H12N2O4 — CID 138858138
(4E)-4-[(4-nitrophenyl)methylidene]-3-phenyl-1,3-oxazolidin-2-one (PubChem CID 138858138) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is (4E)-4-[(4-nitrophenyl)methylidene]-3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4E)-4-[(4-nitrophenyl)methylidene]-3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 138858138 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (4E)-4-[(4-nitrophenyl)methylidene]-3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC/C(=C\c2ccc([N+](=O)[O-])cc2)N1c1ccccc1 |
| InChI | InChI=1S/C16H12N2O4/c19-16-17(13-4-2-1-3-5-13)15(11-22-16)10-12-6-8-14(9-7-12)18(20)21/h1-10H,11H2/b15-10+ |
| InChIKey | FYLYCIVGHGOMGR-XNTDXEJSSA-N |
| XLogP | 3.59 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|