C21H27N2O3+ — CID 138911114
methyl (1R,12R,19R)-12-[(1R)-1-hydroxyethyl]-8-aza-16-azoniapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate (PubChem CID 138911114) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is methyl (1R,12R,19R)-12-[(1R)-1-hydroxyethyl]-8-aza-16-azoniapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate.
| Compound Name | methyl (1R,12R,19R)-12-[(1R)-1-hydroxyethyl]-8-aza-16-azoniapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 138911114 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | methyl (1R,12R,19R)-12-[(1R)-1-hydroxyethyl]-8-aza-16-azoniapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2Nc3ccccc3[C@@]23CC[NH+]2CCC[C@@]([C@@H](C)O)(C1)[C@H]23 |
| InChI | InChI=1S/C21H26N2O3/c1-13(24)20-8-5-10-23-11-9-21(19(20)23)15-6-3-4-7-16(15)22-17(21)14(12-20)18(25)26-2/h3-4,6-7,13,19,22,24H,5,8-12H2,1-2H3/p+1/t13-,19+,20+,21+/m1/s1 |
| InChIKey | BKMGDPNQILJWLI-VLCNGCBASA-O |
| XLogP | 1.00 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |