C21H26N2O4 — CID 163044783
methyl 5-hydroxy-12-(1-hydroxyethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate (PubChem CID 163044783) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is methyl 5-hydroxy-12-(1-hydroxyethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate.
| Compound Name | methyl 5-hydroxy-12-(1-hydroxyethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 163044783 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | methyl 5-hydroxy-12-(1-hydroxyethyl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2Nc3cc(O)ccc3C23CCN2CCCC(C(C)O)(C1)C23 |
| InChI | InChI=1S/C21H26N2O4/c1-12(24)20-6-3-8-23-9-7-21(19(20)23)15-5-4-13(25)10-16(15)22-17(21)14(11-20)18(26)27-2/h4-5,10,12,19,22,24-25H,3,6-9,11H2,1-2H3 |
| InChIKey | FHMZPCPNSNRDQC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |