C27H34N2O5 — CID 162987261
methyl (1S,12S,19S)-5-methoxy-12-[(1R)-1-(3-methylbut-2-enoyloxy)ethyl]-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate (PubChem CID 162987261) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is methyl (1S,12S,19S)-5-methoxy-12-[(1R)-1-(3-methylbut-2-enoyloxy)ethyl]-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate.
| Compound Name | methyl (1S,12S,19S)-5-methoxy-12-[(1R)-1-(3-methylbut-2-enoyloxy)ethyl]-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 162987261 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | methyl (1S,12S,19S)-5-methoxy-12-[(1R)-1-(3-methylbut-2-enoyloxy)ethyl]-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5,9-tetraene-10-carboxylate |
| SMILES | COC(=O)C1=C2Nc3cc(OC)ccc3[C@]23CCN2CCC[C@](C(C)OC(=O)C=C(C)C)(C1)[C@@H]23 |
| InChI | InChI=1S/C27H34N2O5/c1-16(2)13-22(30)34-17(3)26-9-6-11-29-12-10-27(25(26)29)20-8-7-18(32-4)14-21(20)28-23(27)19(15-26)24(31)33-5/h7-8,13-14,17,25,28H,6,9-12,15H2,1-5H3/t17?,25-,26-,27-/m1/s1 |
| InChIKey | YTBDSGGHFWAARB-ALUGOCLBSA-N |
| XLogP | 3.94 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|